| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:23 UTC |
|---|
| Update Date | 2025-03-21 18:35:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00106390 |
|---|
| Frequency | 25.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16O2 |
|---|
| Molecular Mass | 192.115 |
|---|
| SMILES | Cc1ccc(C)c(CC(C)C(=O)O)c1 |
|---|
| InChI Key | YTSRSCBZVMMYQQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenylpropanesp-xylenes |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidcarboxylic acid derivativephenylpropanearomatic homomonocyclic compoundxyleneorganic oxidemonocarboxylic acid or derivativesp-xyleneorganic oxygen compoundhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
