| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:26 UTC |
|---|
| Update Date | 2025-03-21 18:35:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00106524 |
|---|
| Frequency | 25.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H21O23P5 |
|---|
| Molecular Mass | 651.9162 |
|---|
| SMILES | CC(OC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O)C(=O)O |
|---|
| InChI Key | DUJFYCZMXYIXOT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | inositol phosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | carbonyl groupethercarboxylic acidinositol phosphatecarboxylic acid derivativedialkyl etherorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatealiphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
