| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:47 UTC |
|---|
| Update Date | 2025-03-21 18:35:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00107404 |
|---|
| Frequency | 25.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H20N2O4 |
|---|
| Molecular Mass | 244.1423 |
|---|
| SMILES | CCC(C)C(N)C(=O)NC(CC(=O)O)C(C)=O |
|---|
| InChI Key | ICUUFCGACHGJPD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | hybrid peptides |
|---|
| Direct Parent | hybrid peptides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsbeta amino acids and derivativesbranched fatty acidscarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesisoleucine and derivativesketonesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidesshort-chain keto acids and derivatives |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidfatty amideshort-chain keto acidalpha-amino acid or derivativescarboxylic acid derivativeketoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundisoleucine or derivativesalpha-amino acid amidecarboxamide groupbranched fatty acidn-acyl-aminebeta amino acid or derivativesgamma-keto acidsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundketo acidhybrid peptidehydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
