| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:48 UTC |
|---|
| Update Date | 2025-03-21 18:35:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00107443 |
|---|
| Frequency | 25.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16O5 |
|---|
| Molecular Mass | 276.0998 |
|---|
| SMILES | CC(c1ccc(O)cc1)C(O)c1c(O)cc(O)cc1O |
|---|
| InChI Key | FHFJIZAVDKWXBY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | 1,2-diaryl-2-propen-1-ols |
|---|
| Subclass | 1,2-diaryl-2-propen-1-ols |
|---|
| Direct Parent | 1,2-diaryl-2-propen-1-ols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaromatic alcoholshydrocarbon derivativesphenylpropanesphloroglucinols and derivativessecondary alcoholsstilbenes |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moietybenzenetriol1-hydroxy-2-unsubstituted benzenoid1,2-diaryl-2-propen-1-ol1-hydroxy-4-unsubstituted benzenoidphenylpropanephloroglucinol derivativearomatic homomonocyclic compoundorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compoundstilbene |
|---|
