| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:52 UTC |
|---|
| Update Date | 2025-03-21 18:35:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00107603 |
|---|
| Frequency | 25.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11N5 |
|---|
| Molecular Mass | 237.1014 |
|---|
| SMILES | Nc1nc2ncnc(N)c2cc1-c1ccccc1 |
|---|
| InChI Key | UZNFLCCMQBIZIN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridopyrimidines |
|---|
| Subclass | pyrido[2,3-d]pyrimidines |
|---|
| Direct Parent | pyrido[2,3-d]pyrimidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundspolyhalopyridinesprimary aminespyridines and derivativespyrimidines and pyrimidine derivatives |
|---|
| Substituents | monocyclic benzene moietyazacyclepolyhalopyridineheteroaromatic compoundpyrimidinepyridinepyrido[2,3-d]pyrimidinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amine2-halopyridineorganic nitrogen compoundimidolactamamine |
|---|
