| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:53 UTC |
|---|
| Update Date | 2025-03-21 18:35:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00107649 |
|---|
| Frequency | 30.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H5N5O6S |
|---|
| Molecular Mass | 286.9961 |
|---|
| SMILES | Nc1nc2ncc(C(=O)OS(=O)(=O)O)nc2c(=O)[nH]1 |
|---|
| InChI Key | ZZTDTAOEMBMEBU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterin carboxylates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazine carboxylic acidspyrimidonessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterlactamamino acid or derivativespyrimidonecarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganic sulfuric acid or derivativesazacycleheteroaromatic compoundpterin-6-carboxylatemonocarboxylic acid or derivativesorganic oxygen compoundpyrazinepyrazine carboxylic acidpyrazine carboxylic acid or derivativeshydrocarbon derivativeprimary amineorganic nitrogen compoundsulfuric acid esteramineorganooxygen compound |
|---|
