| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-21 00:18:54 UTC |
|---|
| Update Date | 2025-03-21 18:35:51 UTC |
|---|
| HMDB ID | HMDB0011720 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00107656 |
|---|
| Name | UDP-N-acetylmuraminate |
|---|
| Frequency | 34.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H31N3O19P2 |
|---|
| Molecular Mass | 679.1027 |
|---|
| SMILES | CC(=O)NC1C(OP(=O)(O)OP(=O)(O)OCC2OC(n3ccc(O)nc3=O)C(O)C2O)OC(CO)C(O)C1OC(C)C(=O)O |
|---|
| InChI Key | NQBRVZNDBBMBLJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | sugar acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesazacyclic compoundscarbonyl compoundscarboxylic acidsdialkyl ethersheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic carbonic acids and derivativesorganic oxidesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespentose phosphatesprimary alcoholspyrimidine ribonucleoside diphosphatespyrimidonessecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundpentose phosphatemonosaccharidepentose-5-phosphatepyrimidonehydroxypyrimidinecarboxylic acid derivativedialkyl etherpyrimidinen-acyl-alpha-hexosaminemuramic_acidorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundcarboxamide grouporganic pyrophosphateoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativespyrimidine ribonucleoside diphosphatephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|