Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 00:18:56 UTC |
---|
Update Date | 2025-03-21 18:35:53 UTC |
---|
HMDB ID | HMDB0033988 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00107755 |
---|
Name | Genistin |
---|
Frequency | 24.9 |
---|
Structure | |
---|
Chemical Formula | C21H20O10 |
---|
Molecular Mass | 432.1056 |
---|
SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(OC3OC(CO)C(O)C(O)C3O)cc(O)c12 |
---|
InChI Key | ZCOLJUOHXJRHDI-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | isoflavonoids |
---|
Subclass | isoflavonoid o-glycosides |
---|
Direct Parent | isoflavonoid o-glycosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersprimary alcoholspyranones and derivativessecondary alcoholsvinylogous acids |
---|
Substituents | phenol ethermonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidisoflavonoid-7-o-glycosidemonosaccharidesaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundpyranoneoxaneprimary alcoholorganoheterocyclic compoundisoflavonealcoholbenzopyranheteroaromatic compoundisoflavonoid o-glycoside1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyransecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
---|