| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:56 UTC |
|---|
| Update Date | 2025-03-21 18:35:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00107771 |
|---|
| Frequency | 24.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14O3S |
|---|
| Molecular Mass | 214.0664 |
|---|
| SMILES | Cc1ccc(C)c(CS(=O)(=O)O)c1C |
|---|
| InChI Key | ZVHBUUUOQHHIRU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganosulfonic acidssulfonyls |
|---|
| Substituents | aromatic homomonocyclic compoundorganosulfonic acid or derivativesmonocyclic benzene moietyorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganosulfonic acidhydrocarbon derivativeorganosulfur compound |
|---|
