| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:18:59 UTC |
|---|
| Update Date | 2025-03-21 18:35:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00107879 |
|---|
| Frequency | 36.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H8NO6PS |
|---|
| Molecular Mass | 228.981 |
|---|
| SMILES | NC(CC(=O)OP(O)(O)=S)C(=O)O |
|---|
| InChI Key | KNAJDOMDEALSCX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty acids and conjugateshydrocarbon derivativesmonoalkylaminesorganic oxidesorganic thiophosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsthiophosphate monoesters |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidfatty acidthiophosphate monoesterorganic thiophosphoric acid or derivativesorganic oxideorganic oxygen compoundaspartic acid or derivativesorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
