| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:07 UTC |
|---|
| Update Date | 2025-03-21 18:35:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00108221 |
|---|
| Frequency | 24.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18O7 |
|---|
| Molecular Mass | 298.1053 |
|---|
| SMILES | O=C(O)Cc1ccccc1C1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | UPEKHEJARUKNQB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivativedialkyl etheroxacycleorganic oxidemonocarboxylic acid or derivativessecondary alcoholhydrocarbon derivativebenzenoidoxaneprimary alcoholorganoheterocyclic compound |
|---|
