Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:19:17 UTC |
---|
Update Date | 2025-03-21 18:36:02 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00108596 |
---|
Frequency | 24.7 |
---|
Structure | |
---|
Chemical Formula | C32H49NO10 |
---|
Molecular Mass | 607.3356 |
---|
SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C3CC=C4CC(OC5OC(C(=O)O)C(O)C(O)C5O)CCC4(C)C3CCC12C |
---|
InChI Key | YHMFNAUMPXWSPZ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | lipids and lipid-like molecules |
---|
Class | steroids and steroid derivatives |
---|
Subclass | steroidal glycosides |
---|
Direct Parent | steroid glucuronide conjugates |
---|
Geometric Descriptor | aliphatic heteropolycyclic compounds |
---|
Alternative Parents | acetalsacyl glycinesalpha amino acidsbeta hydroxy acids and derivativesbile acids, alcohols and derivativescarbonyl compoundscarboxylic acidsdelta-5-steroidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesmonosaccharidesn-acyl amineso-glucuronidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
---|
Substituents | fatty acylcarbonyl groupcarboxylic acidglucuronic acid or derivativesfatty amideo-glucuronidemonosaccharidealpha-amino acid or derivativescarboxylic acid derivativebile acid, alcohol, or derivativespyran carboxylic acid1-o-glucuronidealiphatic heteropolycyclic compoundbeta-hydroxy acidsaccharideorganic oxideacetalorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesdelta-5-steroidalcoholpyran carboxylic acid or derivativesn-acyl-alpha-amino acidhydroxy acidcarboxamide groupn-acyl-aminen-acylglycineoxacyclesecondary carboxylic acid amideorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativessteroid-glucuronide-skeletonhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|