| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:23 UTC |
|---|
| Update Date | 2025-03-21 18:36:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00108841 |
|---|
| Frequency | 24.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H14O10P2 |
|---|
| Molecular Mass | 308.0062 |
|---|
| SMILES | O=P(O)(O)CC1OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | YBOWGOLYQKBCFB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsdialkyl ethershydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | etherpentose phosphatepentose-5-phosphatedialkyl etherorganic oxidealiphatic heteromonocyclic compoundorganopnictogen compoundorganophosphorus compoundorganophosphonic acid derivativeorganoheterocyclic compound1,2-diolalcoholtetrahydrofuranoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
