| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:24 UTC |
|---|
| Update Date | 2025-03-21 18:36:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00108913 |
|---|
| Frequency | 24.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11NO8P2 |
|---|
| Molecular Mass | 310.996 |
|---|
| SMILES | CC(=O)Nc1ccc(OP(=O)(O)OP(=O)(O)O)cc1 |
|---|
| InChI Key | ZENSHFVEGJBSOT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganic pyrophosphatesorganopnictogen compoundsphenoxy compoundsphosphate esterssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupn-acetylarylamineacetaniliden-arylamidecarboxamide groupcarboxylic acid derivativeorganic pyrophosphatearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundphosphoric acid esterorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganic phosphoric acid derivativeacetamideorganooxygen compound |
|---|
