| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:19:28 UTC |
|---|
| Update Date | 2025-03-21 18:36:07 UTC |
|---|
| HMDB ID | HMDB0301727 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00109079 |
|---|
| Name | p-Coumaroyl glycolic acid |
|---|
| Frequency | 24.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O5 |
|---|
| Molecular Mass | 222.0528 |
|---|
| SMILES | O=C(O)COC(=O)C=Cc1ccc(O)cc1 |
|---|
| InChI Key | RMPWEBYRPJQKNT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesenoate estersfatty acid estershydrocarbon derivativesorganic oxides |
|---|
| Substituents | enoate esterfatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acid1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativehydroxycinnamic acidaromatic homomonocyclic compoundalpha,beta-unsaturated carboxylic esterfatty acid esterorganic oxideorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
