| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:30 UTC |
|---|
| Update Date | 2025-03-21 18:36:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00109142 |
|---|
| Frequency | 24.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8Cl2N2O4S |
|---|
| Molecular Mass | 297.9582 |
|---|
| SMILES | NS(=O)(=O)c1cc(Cl)c(NC(=O)CO)cc1Cl |
|---|
| InChI Key | OTNRAVZHFUCUIO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsaminosulfonyl compoundsanilidesaryl chloridesbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativesdichlorobenzeneshydrocarbon derivativesn-arylamidesorganic oxidesorganochloridesorganopnictogen compoundsorganosulfonamidessecondary carboxylic acid amides |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl grouporganochloriden-arylamideorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundbenzenesulfonyl grouparyl chloridechlorobenzenealcoholbenzenesulfonamide1,4-dichlorobenzeneaminosulfonyl compoundcarboxamide grouparyl halidearomatic homomonocyclic compoundanilidesecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
