| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:19:31 UTC |
|---|
| Update Date | 2025-03-21 18:36:08 UTC |
|---|
| HMDB ID | HMDB0242545 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00109168 |
|---|
| Name | (2s,3r,4s,5r)-3,4,5-Trihydroxy-6-oxopiperidine-2-carboxylic acid |
|---|
| Frequency | 31.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9NO6 |
|---|
| Molecular Mass | 191.043 |
|---|
| SMILES | O=C1NC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | YEWOHTVJCCDCCS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdelta lactamshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinecarboxylic acidspiperidinonessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidbeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundpiperidinonepiperidinecarboxylic acidpiperidineorganoheterocyclic compoundalcoholazacyclehydroxy acidcarboxamide groupdelta-lactamsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
