| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:32 UTC |
|---|
| Update Date | 2025-03-21 18:36:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00109234 |
|---|
| Frequency | 24.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11O10P |
|---|
| Molecular Mass | 274.009 |
|---|
| SMILES | O=CC(O)C(O)C(O)C(O)C(=O)OP(=O)(O)O |
|---|
| InChI Key | PIZQVZZZKHOXMB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl monophosphatesalpha-hydroxyaldehydesbeta hydroxy acids and derivativesbeta-hydroxy aldehydeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganic phosphoric acids and derivativessecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundbeta-hydroxy aldehydecarbonyl groupglucuronic acid or derivativesacyl monophosphatemonosaccharidealdehydehydroxy acidcarboxylic acid derivativebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesalpha-hydroxyaldehydesecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativeacyl phosphate |
|---|
