| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:33 UTC |
|---|
| Update Date | 2025-03-21 18:36:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00109256 |
|---|
| Frequency | 38.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H8O9P2S |
|---|
| Molecular Mass | 281.9364 |
|---|
| SMILES | O=C(O)C(COP(O)(O)=S)OP(=O)(O)O |
|---|
| InChI Key | FEDICAYKEMAOKZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | sugar acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesthiophosphate monoesters |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidthiophosphoric acid estercarboxylic acid derivativethiophosphate monoesterorganic thiophosphoric acid or derivativesorganic oxidemonocarboxylic acid or derivativesphosphoric acid esterglyceric_acidmonoalkyl phosphatehydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
