| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:38 UTC |
|---|
| Update Date | 2025-03-21 18:36:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00109471 |
|---|
| Frequency | 33.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9ClN4O |
|---|
| Molecular Mass | 212.0465 |
|---|
| SMILES | N=C(NC(N)=O)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | SENRXQNLMOCTKF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | chlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboximidamidesguanidineshydrocarbon derivativesiminesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganopnictogen compounds |
|---|
| Substituents | aryl chloridechlorobenzenecarbonyl groupcarbonic acid derivativeguanidineimineorganochloridecarboximidamideorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
