| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:42 UTC |
|---|
| Update Date | 2025-03-21 18:36:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00109616 |
|---|
| Frequency | 24.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18O12 |
|---|
| Molecular Mass | 354.0798 |
|---|
| SMILES | O=C(O)C1OC(OCC2OC(O)C(O)C(O)C2O)(C(=O)O)CC1O |
|---|
| InChI Key | XYDZGMIDGGXXNB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesketalsmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidtetrahydrofuranmonosaccharidecarboxylic acid derivativeoxacyclebeta-hydroxy acidsaccharideorganic oxideorganic oxygen compoundacetalketalaliphatic heteromonocyclic compoundsecondary alcoholdicarboxylic acid or derivativeshemiacetalhydrocarbon derivativeoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
