Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-21 00:19:43 UTC |
---|
Update Date | 2025-03-21 18:36:15 UTC |
---|
HMDB ID | HMDB0000489 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00109679 |
---|
Name | Aspartylglycosamine |
---|
Frequency | 24.4 |
---|
Structure | |
---|
Chemical Formula | C12H21N3O8 |
---|
Molecular Mass | 335.1329 |
---|
SMILES | CC(O)=NC1C(NC(=O)CC(N)C(=O)O)OC(CO)C(O)C1O |
---|
InChI Key | YTTRPBWEMMPYSW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | lipids and lipid-like molecules |
---|
Class | fatty acyls |
---|
Subclass | fatty acyl glycosides |
---|
Direct Parent | fatty acyl glycosides |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | alpha amino acidsasparagine and derivativescarbonyl compoundscarboximidic acidscarboxylic acidsheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspropargyl-type 1,3-dipolar organic compoundssecondary alcoholssecondary carboxylic acid amidesshort-chain hydroxy acids and derivatives |
---|
Substituents | carboximidic acidcarbonyl groupcarboxylic acidshort-chain hydroxy acidheterocyclic fatty acidfatty amidemonosaccharidefatty acidalpha-amino acid or derivativescarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundsaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydroxy fatty acidasparagine or derivativesoxaneprimary alcoholorganoheterocyclic compoundalcoholorganic 1,3-dipolar compoundfatty n-acyl glycosidecarboxamide groupn-acyl-amineoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|