| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:19:47 UTC |
|---|
| Update Date | 2025-03-21 18:36:17 UTC |
|---|
| HMDB ID | HMDB0029543 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00109810 |
|---|
| Name | (+)-Ligballinol |
|---|
| Frequency | 24.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H18O4 |
|---|
| Molecular Mass | 298.1205 |
|---|
| SMILES | Oc1ccc(C2OCC3C(c4ccc(O)cc4)OCC23)cc1 |
|---|
| InChI Key | AYMLHOROIXAYPH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | furanoid lignans |
|---|
| Subclass | furan lignans |
|---|
| Direct Parent | furan lignans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativesdialkyl ethersfurofuran lignansfurofuranshydrocarbon derivativesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietyetherfurofuran lignan skeletontetrahydrofuran1-hydroxy-2-unsubstituted benzenoiddialkyl etheroxacyclefuran lignan skeletonorganic oxygen compoundaromatic heteropolycyclic compoundfurofuranphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
