| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:52 UTC |
|---|
| Update Date | 2025-03-21 18:36:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00110037 |
|---|
| Frequency | 24.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17N3O4 |
|---|
| Molecular Mass | 291.1219 |
|---|
| SMILES | Nc1c(-c2ccccc2)ncn1C1OC(CO)C(O)C1O |
|---|
| InChI Key | XLAQXPLRZZOQON-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | imidazole ribonucleosides and ribonucleotides |
|---|
| Subclass | imidazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | imidazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsphenylimidazolesprimary alcoholsprimary aminessecondary alcoholstetrahydrofurans |
|---|
| Substituents | imidazole ribonucleosidemonocyclic benzene moietyaromatic heteromonocyclic compoundmonosaccharide4-phenylimidazolesaccharideimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacycle5-phenylimidazoleorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
