| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:57 UTC |
|---|
| Update Date | 2025-03-21 18:36:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00110254 |
|---|
| Frequency | 24.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H13NO2 |
|---|
| Molecular Mass | 263.0946 |
|---|
| SMILES | O=C(O)c1cccc2cccc(Nc3ccccc3)c12 |
|---|
| InChI Key | OZGZWHZSRYBLEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenecarboxylic acids and derivatives |
|---|
| Direct Parent | naphthalenecarboxylic acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsamino acidsbenzene and substituted derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundssecondary amines |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidamino acid or derivativesamino acidaromatic homopolycyclic compound1-naphthalenecarboxylic acidsecondary aminecarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative1-carboxy-2-haloaromatic compoundorganic nitrogen compoundorganooxygen compoundamine |
|---|
