| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:58 UTC |
|---|
| Update Date | 2025-03-21 18:36:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00110266 |
|---|
| Frequency | 24.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17NO4 |
|---|
| Molecular Mass | 239.1158 |
|---|
| SMILES | OCC1OC(NCc2ccccc2)C(O)C1O |
|---|
| InChI Key | XXVKZHVDFNOIFZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | dialkylamineshemiaminalshydrocarbon derivativesmonosaccharidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholsecondary aliphatic aminemonocyclic benzene moietyaromatic heteromonocyclic compoundtetrahydrofuranmonosaccharidesecondary aminehemiaminaloxacyclesaccharideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundorganooxygen compoundamine |
|---|
