| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:19:59 UTC |
|---|
| Update Date | 2025-03-21 18:36:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00110328 |
|---|
| Frequency | 24.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H15NO6P+ |
|---|
| Molecular Mass | 228.0632 |
|---|
| SMILES | C[N+](C)(C)C(CC(=O)O)OP(=O)(O)O |
|---|
| InChI Key | YWCBZIUFHVFTLZ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganonitrogen compoundsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidtetraalkylammonium saltcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphateorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltorganooxygen compound |
|---|
