| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:20:02 UTC |
|---|
| Update Date | 2025-03-21 18:36:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00110441 |
|---|
| Frequency | 24.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO6 |
|---|
| Molecular Mass | 297.1212 |
|---|
| SMILES | Cc1ccccc1C(=O)NC1C(O)OC(CO)C(O)C1O |
|---|
| InChI Key | ZWRASUMSHKKCJN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | benzamidesbenzoyl derivativescarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amideso-toluamides |
|---|
| Substituents | monocyclic benzene moietyaromatic heteromonocyclic compoundbenzoylmonosaccharidecarboxylic acid derivativetoluamidebenzamiden-acyl-alpha-hexosamineorganic oxideo-toluamideorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholbenzoic acid or derivativescarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundtoluene |
|---|
