| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:20:04 UTC |
|---|
| Update Date | 2025-03-21 18:36:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00110514 |
|---|
| Frequency | 24.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H17NO |
|---|
| Molecular Mass | 251.131 |
|---|
| SMILES | Cc1cccc(C)c1NC(=O)C=Cc1ccccc1 |
|---|
| InChI Key | RGVUJGWQEVQKSO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | anilidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidesm-xylenes |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupm-xylenen-arylamidecarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundxyleneanilidesecondary carboxylic acid amidecinnamic acid or derivativesorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
