Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-21 00:20:32 UTC |
---|
Update Date | 2025-03-21 18:36:37 UTC |
---|
HMDB ID | HMDB0127765 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00111621 |
---|
Name | 4-hydroxy-5-(3-methoxyphenyl)pentanoic acid |
---|
Frequency | 23.8 |
---|
Structure | |
---|
Chemical Formula | C12H16O4 |
---|
Molecular Mass | 224.1049 |
---|
SMILES | COc1cccc(CC(O)CCC(=O)O)c1 |
---|
InChI Key | CKZKUWLXOYONBS-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | lipids and lipid-like molecules |
---|
Class | fatty acyls |
---|
Subclass | fatty acids and conjugates |
---|
Direct Parent | carbocyclic fatty acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundscarboxylic acidshydrocarbon derivativeshydroxy fatty acidsmedium-chain fatty acidsmedium-chain hydroxy acids and derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundssecondary alcohols |
---|
Substituents | carbocyclic fatty acidphenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidalkyl aryl ethercarboxylic acid derivativemedium-chain hydroxy acidorganic oxidemedium-chain fatty acidhydroxy fatty acidalcoholmethoxybenzenearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
---|