| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:20:32 UTC |
|---|
| Update Date | 2025-03-21 18:36:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00111649 |
|---|
| Frequency | 23.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8O6S |
|---|
| Molecular Mass | 244.0042 |
|---|
| SMILES | CS(=O)(=O)OC(=O)c1ccccc1C(=O)O |
|---|
| InChI Key | KHQUABIMVGFLJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesmethanesulfonatesorganic oxidesorganooxygen compoundsorganosulfonic acids and derivativessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativescarboxylic acidbenzoylorganosulfur compoundcarboxylic acid derivativearomatic homomonocyclic compoundmethanesulfonateorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesdicarboxylic acid or derivativeshydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compound |
|---|
