| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:20:34 UTC |
|---|
| Update Date | 2025-03-21 18:36:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00111703 |
|---|
| Frequency | 23.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H7O8P |
|---|
| Molecular Mass | 213.9879 |
|---|
| SMILES | O=C(O)C(O)COP(=O)(O)C(=O)O |
|---|
| InChI Key | JSEAPNXDTFJFME-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | sugar acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarbonic acid derivativecarboxylic acidalpha-hydroxy acidmonosaccharidehydroxy acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesglyceric_acidsecondary alcoholorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganophosphonic acid derivative |
|---|
