| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:20:43 UTC |
|---|
| Update Date | 2025-03-21 18:36:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00112078 |
|---|
| Frequency | 23.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18N2O |
|---|
| Molecular Mass | 218.1419 |
|---|
| SMILES | NC(Cc1ccccc1)C(=O)C1CCCN1 |
|---|
| InChI Key | DWFUHTANMWCPFR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesdialkylamineshydrocarbon derivativesketonesmonoalkylaminesorganic oxidesorganopnictogen compoundspyrrolidines |
|---|
| Substituents | secondary aliphatic aminecarbonyl grouparomatic heteromonocyclic compoundazacyclesecondary amineketoneorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundpyrrolidineorganoheterocyclic compoundorganooxygen compoundamphetamine or derivativesamine |
|---|
