| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:20:44 UTC |
|---|
| Update Date | 2025-03-21 18:36:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00112133 |
|---|
| Frequency | 23.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11NO5S |
|---|
| Molecular Mass | 209.0358 |
|---|
| SMILES | O=C(O)C1CCN(S(=O)(=O)O)CC1 |
|---|
| InChI Key | YZZAIDBLWUJRMN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | piperidinecarboxylic acids and derivatives |
|---|
| Direct Parent | piperidinecarboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinessulfuric acid monoamides |
|---|
| Substituents | carbonyl groupcarboxylic acidorganic sulfuric acid or derivativesazacyclecarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundsulfuric acid monoamideorganopnictogen compoundhydrocarbon derivativepiperidinecarboxylic acidorganic nitrogen compoundorganooxygen compound |
|---|
