| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:20:48 UTC |
|---|
| Update Date | 2025-03-21 18:36:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00112292 |
|---|
| Frequency | 23.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H11NO3 |
|---|
| Molecular Mass | 217.0739 |
|---|
| SMILES | COc1ccc(NC(=O)c2ccco2)cc1 |
|---|
| InChI Key | BAPQOHAPCRWHRC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | 2-furanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidesalkyl aryl ethersanisolescarboxylic acids and derivativesfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | furanphenol etheretheraromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivative2-heteroaryl carboxamideorganic oxide2-furanilideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundfuroic acid or derivativesheteroaromatic compoundcarboxamide groupmethoxybenzeneoxacyclesecondary carboxylic acid amideorganic oxygen compoundanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
