| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:20:54 UTC |
|---|
| Update Date | 2025-03-21 18:36:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00112503 |
|---|
| Frequency | 23.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10N2O6S |
|---|
| Molecular Mass | 226.026 |
|---|
| SMILES | NS(=O)(=O)NC(CCC(=O)O)C(=O)O |
|---|
| InChI Key | ZYYFXKZXQCQRTJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty acids and conjugateshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfuric acid diamides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidorganic sulfuric acid or derivativesfatty acidglutamic acid or derivativessulfuric acid diamideorganic oxideorganic oxygen compoundorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
