| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:20:55 UTC |
|---|
| Update Date | 2025-03-21 18:36:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00112578 |
|---|
| Frequency | 23.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20O2 |
|---|
| Molecular Mass | 220.1463 |
|---|
| SMILES | CC(c1ccc(O)cc1)C1(O)CCCCC1 |
|---|
| InChI Key | ITQONOZFPUUMJE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativescyclic alcohols and derivativeshydrocarbon derivativestertiary alcohols |
|---|
| Substituents | monocyclic benzene moietycyclohexanol1-hydroxy-2-unsubstituted benzenoidcyclic alcoholaromatic homomonocyclic compoundtertiary alcoholphenolhydrocarbon derivativebenzenoid |
|---|
