| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:20:59 UTC |
|---|
| Update Date | 2025-03-21 18:36:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00112723 |
|---|
| Frequency | 23.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H23NO2 |
|---|
| Molecular Mass | 309.1729 |
|---|
| SMILES | CC(C)NCC(O)COc1ccc2c(ccc3ccccc32)c1 |
|---|
| InChI Key | AJCBGEQHJSLGJN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersdialkylamineshydrocarbon derivativesnaphthalenesorganopnictogen compoundsphenol etherssecondary alcohols |
|---|
| Substituents | alcoholphenol ethersecondary aliphatic aminephenanthreneetheraromatic homopolycyclic compoundalkyl aryl ethersecondary aminenaphthaleneorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
