| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:01 UTC |
|---|
| Update Date | 2025-03-21 18:36:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00112775 |
|---|
| Frequency | 38.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H9N5 |
|---|
| Molecular Mass | 211.0858 |
|---|
| SMILES | Nc1ncnc2[nH]c(-c3ccccc3)nc12 |
|---|
| InChI Key | KFMQOHDPKOQCMU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azoles |
|---|
| Subclass | imidazoles |
|---|
| Direct Parent | phenylimidazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsorganopnictogen compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivatives |
|---|
| Substituents | monocyclic benzene moietyazacycleheteroaromatic compoundimidazopyrimidinepyrimidinearomatic heteropolycyclic compound2-phenylimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary aminepurineorganic nitrogen compoundimidolactamamine |
|---|