| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:04 UTC |
|---|
| Update Date | 2025-03-21 18:36:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00112933 |
|---|
| Frequency | 23.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H45N5O10 |
|---|
| Molecular Mass | 611.3166 |
|---|
| SMILES | NC(CCCc1c(CCC(N)C(=O)O)cc(CCC(N)C(=O)O)c(CCCC(N)C(=O)O)c1CCC(N)C(=O)O)C(=O)O |
|---|
| InChI Key | UXLPWXXTHCGJBH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | pentacarboxylic acids and derivatives |
|---|
| Direct Parent | pentacarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylbutylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidalpha-amino acid or derivativespentacarboxylic acid or derivativesaromatic homomonocyclic compoundorganic oxidephenylbutylamineorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
