| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:10 UTC |
|---|
| Update Date | 2025-03-21 18:36:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00113172 |
|---|
| Frequency | 23.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N4O7 |
|---|
| Molecular Mass | 314.0862 |
|---|
| SMILES | COc1nc2c(O)nc(=O)n(C3OC(CO)C(O)C3O)c2[nH]1 |
|---|
| InChI Key | MVTBJUBJIHGZOZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | xanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkaloids and derivativesalkyl aryl ethersazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurinonespyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | ethermonosaccharidepyrimidonehydroxypyrimidinealkyl aryl etherpurinonepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholazolealcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundxanthineoxacyclealkaloid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
