| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:11 UTC |
|---|
| Update Date | 2025-03-21 18:36:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00113206 |
|---|
| Frequency | 23.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9N5O4 |
|---|
| Molecular Mass | 251.0655 |
|---|
| SMILES | Nc1nc2ncc(C(=O)C(O)CO)nc2c(=O)[nH]1 |
|---|
| InChI Key | PTPXYULJWUJPTF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacyloinsaryl alkyl ketonesazacyclic compoundsbeta-hydroxy ketonesheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | beta-hydroxy ketonelactamaryl alkyl ketonemonosaccharidepyrimidonepyrimidineketonesaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcohol1,2-diolalcoholpterinazacycleheteroaromatic compoundorganic oxygen compoundpyrazineacyloinsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compoundaryl ketone |
|---|
