Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:21:12 UTC |
---|
Update Date | 2025-03-21 18:36:57 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00113239 |
---|
Frequency | 23.4 |
---|
Structure | |
---|
Chemical Formula | C10H11NO7S |
---|
Molecular Mass | 289.0256 |
---|
SMILES | NC(CC(=O)c1cccc(OS(=O)(=O)O)c1)C(=O)O |
---|
InChI Key | PXKILWZONBFEAE-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbonyl compounds |
---|
Direct Parent | alkyl-phenylketones |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidsaryl alkyl ketonesbenzoyl derivativesbutyrophenonescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsphenylsulfatessulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietysulfuric acid monoestercarboxylic acidaryl alkyl ketonebenzoylalpha-amino acid or derivativescarboxylic acid derivativephenylsulfateorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundarylsulfateorganic sulfuric acid or derivativesgamma-keto acidbutyrophenonearomatic homomonocyclic compoundmonocarboxylic acid or derivativesketo acidsulfate-esterhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundphenoxy compoundsulfuric acid esteralkyl-phenylketone |
---|