| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:15 UTC |
|---|
| Update Date | 2025-03-21 18:36:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00113348 |
|---|
| Frequency | 23.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8O7 |
|---|
| Molecular Mass | 192.027 |
|---|
| SMILES | CC(=O)OC(=O)CC(O)(O)C(=O)O |
|---|
| InChI Key | RGQCRLXDXRYOSL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarbonyl hydratescarboxylic acid anhydridescarboxylic acidshydrocarbon derivativesorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidcarbonyl hydratealpha-hydroxy acidtricarboxylic acid or derivativeshydroxy acidorganic oxideorganic oxygen compoundcarboxylic acid anhydridehydrocarbon derivativeorganooxygen compound |
|---|
