| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:17 UTC |
|---|
| Update Date | 2025-03-21 18:36:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00113452 |
|---|
| Frequency | 23.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N2O5 |
|---|
| Molecular Mass | 256.1059 |
|---|
| SMILES | COC1CC(n2cc(C)c(=O)[nH]c2=O)OC1CO |
|---|
| InChI Key | ZGBKEOLAPVBJFC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleosides |
|---|
| Subclass | pyrimidine nucleosides |
|---|
| Direct Parent | pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrimidonestetrahydrofuransvinylogous amides |
|---|
| Substituents | alcoholvinylogous amideethercarbonic acid derivativelactamaromatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundpyrimidonedialkyl etherpyrimidineoxacycleorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativepyrimidine nucleosideorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
