| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:21 UTC |
|---|
| Update Date | 2025-03-21 18:37:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00113625 |
|---|
| Frequency | 23.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H26O4 |
|---|
| Molecular Mass | 378.1831 |
|---|
| SMILES | OCC(Cc1cccc(O)c1)C(Cc1cccc(O)c1)Cc1cccc(O)c1 |
|---|
| InChI Key | ZACBMIHWQJOGTB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | dibenzylbutane lignans |
|---|
| Subclass | dibenzylbutane lignans |
|---|
| Direct Parent | dibenzylbutane lignans |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescinnamylphenolshydrocarbon derivativesprimary alcohols |
|---|
| Substituents | alcohollinear 1,3-diarylpropanoidmonocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoidcinnamylphenol1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compounddibenzylbutane lignan skeletonorganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary alcoholorganooxygen compound |
|---|
