| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:23 UTC |
|---|
| Update Date | 2025-03-21 18:37:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00113713 |
|---|
| Frequency | 23.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N3O6 |
|---|
| Molecular Mass | 259.0804 |
|---|
| SMILES | O=C(O)Cc1cn(C2OC(CO)C(O)C2O)nn1 |
|---|
| InChI Key | PZVJTIUAAQKFHA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | triazole ribonucleosides and ribonucleotides |
|---|
| Subclass | triazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | triazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofuranstriazoles |
|---|
| Substituents | n-ribosyl-1,2,3-triazoletriazolecarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcohol1,2,3-triazoleorganoheterocyclic compoundazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
