| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:24 UTC |
|---|
| Update Date | 2025-03-21 18:37:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00113747 |
|---|
| Frequency | 23.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17NO8 |
|---|
| Molecular Mass | 291.0954 |
|---|
| SMILES | O=C1CC(O)(C(=O)O)CCN1C1OC(CO)C(O)C1O |
|---|
| InChI Key | CCLYFBXCDZKHHZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | piperidinecarboxylic acids and derivatives |
|---|
| Direct Parent | piperidinecarboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidsdelta lactamshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspiperidinonesprimary alcoholssecondary alcoholstertiary alcoholstertiary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidalpha-hydroxy acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxidetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinonepiperidinecarboxylic acidprimary alcoholalcoholazacycletetrahydrofuranhydroxy acidcarboxamide groupdelta-lactamoxacycletertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
