| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:28 UTC |
|---|
| Update Date | 2025-03-21 18:37:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00113892 |
|---|
| Frequency | 23.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H24N2O |
|---|
| Molecular Mass | 248.1889 |
|---|
| SMILES | CN(C)CC(c1ccccn1)C1(O)CCCCC1 |
|---|
| InChI Key | BJDDGDWDFGBNQK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-aminoalcohols2-halopyridinesazacyclic compoundscyclic alcohols and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesorganopnictogen compoundstertiary alcoholstrialkylamines |
|---|
| Substituents | 1,3-aminoalcoholaromatic heteromonocyclic compoundazacycleheteroaromatic compoundtertiary aliphatic aminehydroxypyridinecyclohexanolmethylpyridinecyclic alcoholtertiary alcoholpyridineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative2-halopyridineorganic nitrogen compoundaminetertiary amineorganoheterocyclic compound |
|---|
