| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:21:28 UTC |
|---|
| Update Date | 2025-03-21 18:37:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00113900 |
|---|
| Frequency | 32.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N5O6 |
|---|
| Molecular Mass | 301.1022 |
|---|
| SMILES | Nc1nc2c([nH]c(=O)n2CC(O)C(O)C(O)CO)c(=O)[nH]1 |
|---|
| InChI Key | RLTJVUMDPQUHBE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholazolen-substituted imidazolealcoholvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
